C22H23F2NO — CID 67595253
4-[[4-(4-ethylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile (PubChem CID 67595253) has the molecular formula C22H23F2NO and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-[[4-(4-ethylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile.
| Compound Name | 4-[[4-(4-ethylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile |
|---|---|
| PubChem CID | 67595253 |
| Molecular Formula | C22H23F2NO |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-[[4-(4-ethylcyclohexyl)phenyl]-difluoromethoxy]benzonitrile |
| SMILES | CCC1CCC(c2ccc(C(F)(F)Oc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H23F2NO/c1-2-16-3-7-18(8-4-16)19-9-11-20(12-10-19)22(23,24)26-21-13-5-17(15-25)6-14-21/h5-6,9-14,16,18H,2-4,7-8H2,1H3 |
| InChIKey | HKLBOHWTXDVYCU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |