C25H27F4NO — CID 139812818
4-[difluoro-[4-(4-pentylcyclohexyl)phenoxy]methyl]-2,6-difluorobenzonitrile (PubChem CID 139812818) has the molecular formula C25H27F4NO and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-[difluoro-[4-(4-pentylcyclohexyl)phenoxy]methyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenoxy]methyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139812818 |
| Molecular Formula | C25H27F4NO |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenoxy]methyl]-2,6-difluorobenzonitrile |
| SMILES | CCCCCC1CCC(c2ccc(OC(F)(F)c3cc(F)c(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H27F4NO/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-21(13-11-19)31-25(28,29)20-14-23(26)22(16-30)24(27)15-20/h10-15,17-18H,2-9H2,1H3 |
| InChIKey | FXIRLSKUKRXUCS-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|