About 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane
4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane (PubChem CID 158309078) has the molecular formula C16H13F4NO
and a molecular weight of 311.28 g/mol. Its IUPAC name is 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane.
Molecular Properties
| Compound Name | 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane |
| PubChem CID | 158309078 |
| Molecular Formula | C16H13F4NO |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane |
| SMILES | C.Cc1ccc(C(F)(F)Oc2cc(F)c(C#N)c(F)c2)cc1 |
| InChI | InChI=1S/C15H9F4NO.CH4/c1-9-2-4-10(5-3-9)15(18,19)21-11-6-13(16)12(8-20)14(17)7-11;/h2-7H,1H3;1H4 |
| InChIKey | GNLKJJIXDFPOQJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane?
The IUPAC name of 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane (CID 158309078) is 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane.
What is the SMILES notation for 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane?
The canonical SMILES for 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane is C.Cc1ccc(C(F)(F)Oc2cc(F)c(C#N)c(F)c2)cc1.
What is the InChIKey of 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane?
The InChIKey is GNLKJJIXDFPOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F4NO.CH4/c1-9-2-4-10(5-3-9)15(18,19)21-11-6-13(16)12(8-20)14(17)7-11;/h2-7H,1H3;1H4.
What are the key properties of 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane?
4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane has a molecular weight of 311.28 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[difluoro-(4-methylphenyl)methoxy]-2,6-difluorobenzonitrile;methane is sourced from PubChem (CID 158309078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).