About 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile
4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile (PubChem CID 142292246) has the molecular formula C14H5BrF5NO
and a molecular weight of 378.09 g/mol. Its IUPAC name is 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile |
| PubChem CID | 142292246 |
| Molecular Formula | C14H5BrF5NO |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(OC(F)(F)c2ccc(Br)cc2F)cc1F |
| InChI | InChI=1S/C14H5BrF5NO/c15-7-1-2-10(13(18)3-7)14(19,20)22-8-4-11(16)9(6-21)12(17)5-8/h1-5H |
| InChIKey | HWYNLXFXQDDDAN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile?
The IUPAC name of 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile (CID 142292246) is 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile.
What is the SMILES notation for 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile?
The canonical SMILES for 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile is N#Cc1c(F)cc(OC(F)(F)c2ccc(Br)cc2F)cc1F.
What is the InChIKey of 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile?
The InChIKey is HWYNLXFXQDDDAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5BrF5NO/c15-7-1-2-10(13(18)3-7)14(19,20)22-8-4-11(16)9(6-21)12(17)5-8/h1-5H.
What are the key properties of 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile?
4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile has a molecular weight of 378.09 g/mol, XLogP of 4.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromo-2-fluorophenyl)-difluoromethoxy]-2,6-difluorobenzonitrile is sourced from PubChem (CID 142292246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).