C24H21F6NO — CID 173305906
4-[[4-(4-but-1-enyl-2,6-difluorocyclohexyl)phenyl]-difluoromethoxy]-2,6-difluorobenzonitrile (PubChem CID 173305906) has the molecular formula C24H21F6NO and a molecular weight of 453.43 g/mol. Its IUPAC name is 4-[[4-(4-but-1-enyl-2,6-difluorocyclohexyl)phenyl]-difluoromethoxy]-2,6-difluorobenzonitrile.
| Compound Name | 4-[[4-(4-but-1-enyl-2,6-difluorocyclohexyl)phenyl]-difluoromethoxy]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 173305906 |
| Molecular Formula | C24H21F6NO |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-[[4-(4-but-1-enyl-2,6-difluorocyclohexyl)phenyl]-difluoromethoxy]-2,6-difluorobenzonitrile |
| SMILES | CCC=CC1CC(F)C(c2ccc(C(F)(F)Oc3cc(F)c(C#N)c(F)c3)cc2)C(F)C1 |
| InChI | InChI=1S/C24H21F6NO/c1-2-3-4-14-9-21(27)23(22(28)10-14)15-5-7-16(8-6-15)24(29,30)32-17-11-19(25)18(13-31)20(26)12-17/h3-8,11-12,14,21-23H,2,9-10H2,1H3 |
| InChIKey | IMNFFCODTYJNSX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|