C30H38FN — CID 58699021
2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzonitrile (PubChem CID 58699021) has the molecular formula C30H38FN and a molecular weight of 431.64 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 58699021 |
| Molecular Formula | C30H38FN |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzonitrile |
| SMILES | C[C@@H](CC1CCC(CCC2CCC(c3ccc(C#N)c(F)c3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H38FN/c1-22(26-5-3-2-4-6-26)19-25-11-9-23(10-12-25)7-8-24-13-15-27(16-14-24)28-17-18-29(21-32)30(31)20-28/h2-6,17-18,20,22-25,27H,7-16,19H2,1H3/t22-,23?,24?,25?,27?/m0/s1 |
| InChIKey | UIPUOQGBHBOFKP-IQAPFTQCSA-N |
| XLogP | 8.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |