C24H32FN — CID 139629319
2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]benzonitrile (PubChem CID 139629319) has the molecular formula C24H32FN and a molecular weight of 353.53 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 139629319 |
| Molecular Formula | C24H32FN |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2-fluoro-4-[4-[(E)-4-(4-methylcyclohexyl)but-3-enyl]cyclohexyl]benzonitrile |
| SMILES | CC1CCC(/C=C/CCC2CCC(c3ccc(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H32FN/c1-18-6-8-19(9-7-18)4-2-3-5-20-10-12-21(13-11-20)22-14-15-23(17-26)24(25)16-22/h2,4,14-16,18-21H,3,5-13H2,1H3/b4-2+ |
| InChIKey | OUGPDKNJNRJQCF-DUXPYHPUSA-N |
| XLogP | 7.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|