C28H23NS — CID 177335889
2-[2-(4-butylphenyl)ethynyl]-6-(4-isothiocyanatophenyl)-1H-indene (PubChem CID 177335889) has the molecular formula C28H23NS and a molecular weight of 405.57 g/mol. Its IUPAC name is 2-[2-(4-butylphenyl)ethynyl]-6-(4-isothiocyanatophenyl)-1H-indene.
| Compound Name | 2-[2-(4-butylphenyl)ethynyl]-6-(4-isothiocyanatophenyl)-1H-indene |
|---|---|
| PubChem CID | 177335889 |
| Molecular Formula | C28H23NS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[2-(4-butylphenyl)ethynyl]-6-(4-isothiocyanatophenyl)-1H-indene |
| SMILES | CCCCc1ccc(C#CC2=Cc3ccc(-c4ccc(N=C=S)cc4)cc3C2)cc1 |
| InChI | InChI=1S/C28H23NS/c1-2-3-4-21-5-7-22(8-6-21)9-10-23-17-25-11-12-26(19-27(25)18-23)24-13-15-28(16-14-24)29-20-30/h5-8,11-17,19H,2-4,18H2,1H3 |
| InChIKey | JOKITWAUAZSVFJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|