C23H21NS — CID 177335920
6-isothiocyanato-2-[2-(4-pentylphenyl)ethynyl]-1H-indene (PubChem CID 177335920) has the molecular formula C23H21NS and a molecular weight of 343.50 g/mol. Its IUPAC name is 6-isothiocyanato-2-[2-(4-pentylphenyl)ethynyl]-1H-indene.
| Compound Name | 6-isothiocyanato-2-[2-(4-pentylphenyl)ethynyl]-1H-indene |
|---|---|
| PubChem CID | 177335920 |
| Molecular Formula | C23H21NS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 6-isothiocyanato-2-[2-(4-pentylphenyl)ethynyl]-1H-indene |
| SMILES | CCCCCc1ccc(C#CC2=Cc3ccc(N=C=S)cc3C2)cc1 |
| InChI | InChI=1S/C23H21NS/c1-2-3-4-5-18-6-8-19(9-7-18)10-11-20-14-21-12-13-23(24-17-25)16-22(21)15-20/h6-9,12-14,16H,2-5,15H2,1H3 |
| InChIKey | WFXXNOLGAXWXJJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|