C22H18FNS — CID 163576043
2-fluoro-1-[2-[4-(4-isothiocyanatophenyl)phenyl]ethyl]-4-methylbenzene (PubChem CID 163576043) has the molecular formula C22H18FNS and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-fluoro-1-[2-[4-(4-isothiocyanatophenyl)phenyl]ethyl]-4-methylbenzene.
| Compound Name | 2-fluoro-1-[2-[4-(4-isothiocyanatophenyl)phenyl]ethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 163576043 |
| Molecular Formula | C22H18FNS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-fluoro-1-[2-[4-(4-isothiocyanatophenyl)phenyl]ethyl]-4-methylbenzene |
| SMILES | Cc1ccc(CCc2ccc(-c3ccc(N=C=S)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C22H18FNS/c1-16-2-6-20(22(23)14-16)9-5-17-3-7-18(8-4-17)19-10-12-21(13-11-19)24-15-25/h2-4,6-8,10-14H,5,9H2,1H3 |
| InChIKey | GDODMGFLNIBCHO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|