C25H17F2NS — CID 163272964
2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]-1,3-difluoro-5-isothiocyanatobenzene (PubChem CID 163272964) has the molecular formula C25H17F2NS and a molecular weight of 401.48 g/mol. Its IUPAC name is 2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]-1,3-difluoro-5-isothiocyanatobenzene.
| Compound Name | 2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
|---|---|
| PubChem CID | 163272964 |
| Molecular Formula | C25H17F2NS |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]-1,3-difluoro-5-isothiocyanatobenzene |
| SMILES | Fc1cc(N=C=S)cc(F)c1-c1ccc(C#Cc2ccc(CC3CC3)cc2)cc1 |
| InChI | InChI=1S/C25H17F2NS/c26-23-14-22(28-16-29)15-24(27)25(23)21-11-9-18(10-12-21)2-1-17-3-5-19(6-4-17)13-20-7-8-20/h3-6,9-12,14-15,20H,7-8,13H2 |
| InChIKey | AVKFZWOOSYYPQA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|