C24H25FO — CID 20724154
2-fluoro-4-[2-[4-[(4-prop-1-en-2-ylcyclohexyl)methyl]phenyl]ethynyl]phenol (PubChem CID 20724154) has the molecular formula C24H25FO and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-[(4-prop-1-en-2-ylcyclohexyl)methyl]phenyl]ethynyl]phenol.
| Compound Name | 2-fluoro-4-[2-[4-[(4-prop-1-en-2-ylcyclohexyl)methyl]phenyl]ethynyl]phenol |
|---|---|
| PubChem CID | 20724154 |
| Molecular Formula | C24H25FO |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-fluoro-4-[2-[4-[(4-prop-1-en-2-ylcyclohexyl)methyl]phenyl]ethynyl]phenol |
| SMILES | C=C(C)C1CCC(Cc2ccc(C#Cc3ccc(O)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H25FO/c1-17(2)22-12-9-20(10-13-22)15-19-6-3-18(4-7-19)5-8-21-11-14-24(26)23(25)16-21/h3-4,6-7,11,14,16,20,22,26H,1,9-10,12-13,15H2,2H3 |
| InChIKey | RUWHOVNENDNBDF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|