C16H13FO — CID 170842246
4-[2-(4-ethylphenyl)ethynyl]-2-fluorophenol (PubChem CID 170842246) has the molecular formula C16H13FO and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethynyl]-2-fluorophenol.
| Compound Name | 4-[2-(4-ethylphenyl)ethynyl]-2-fluorophenol |
|---|---|
| PubChem CID | 170842246 |
| Molecular Formula | C16H13FO |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethynyl]-2-fluorophenol |
| SMILES | CCc1ccc(C#Cc2ccc(O)c(F)c2)cc1 |
| InChI | InChI=1S/C16H13FO/c1-2-12-3-5-13(6-4-12)7-8-14-9-10-16(18)15(17)11-14/h3-6,9-11,18H,2H2,1H3 |
| InChIKey | SHAYNDYRCILQLI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|