C19H11F2NS — CID 176767967
5-[2-(4-ethylphenyl)ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene (PubChem CID 176767967) has the molecular formula C19H11F2NS and a molecular weight of 323.37 g/mol. Its IUPAC name is 5-[2-(4-ethylphenyl)ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene.
| Compound Name | 5-[2-(4-ethylphenyl)ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
|---|---|
| PubChem CID | 176767967 |
| Molecular Formula | C19H11F2NS |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-[2-(4-ethylphenyl)ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
| SMILES | CCc1ccc(C#Cc2cc(F)c(C#CN=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C19H11F2NS/c1-2-14-3-5-15(6-4-14)7-8-16-11-18(20)17(19(21)12-16)9-10-22-13-23/h3-6,11-12H,2H2,1H3 |
| InChIKey | RXIZTTKORSCPQS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|