C29H17F2NS — CID 176768016
5-[2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene (PubChem CID 176768016) has the molecular formula C29H17F2NS and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-[2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene.
| Compound Name | 5-[2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
|---|---|
| PubChem CID | 176768016 |
| Molecular Formula | C29H17F2NS |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 5-[2-[4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
| SMILES | Fc1cc(C#Cc2ccc(C#Cc3ccc(CC4CC4)cc3)cc2)cc(F)c1C#CN=C=S |
| InChI | InChI=1S/C29H17F2NS/c30-28-18-26(19-29(31)27(28)15-16-32-20-33)14-9-22-4-1-21(2-5-22)3-6-23-7-10-24(11-8-23)17-25-12-13-25/h1-2,4-5,7-8,10-11,18-19,25H,12-13,17H2 |
| InChIKey | AUMWQZZTFBKBON-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|