C23H17F2NOS — CID 176767990
5-[2-[4-(cyclopentylmethoxy)phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene (PubChem CID 176767990) has the molecular formula C23H17F2NOS and a molecular weight of 393.46 g/mol. Its IUPAC name is 5-[2-[4-(cyclopentylmethoxy)phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene.
| Compound Name | 5-[2-[4-(cyclopentylmethoxy)phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
|---|---|
| PubChem CID | 176767990 |
| Molecular Formula | C23H17F2NOS |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 5-[2-[4-(cyclopentylmethoxy)phenyl]ethynyl]-1,3-difluoro-2-(2-isothiocyanatoethynyl)benzene |
| SMILES | Fc1cc(C#Cc2ccc(OCC3CCCC3)cc2)cc(F)c1C#CN=C=S |
| InChI | InChI=1S/C23H17F2NOS/c24-22-13-19(14-23(25)21(22)11-12-26-16-28)6-5-17-7-9-20(10-8-17)27-15-18-3-1-2-4-18/h7-10,13-14,18H,1-4,15H2 |
| InChIKey | ANZFYTLGFMUSFJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|