C18H13F2NOS — CID 101359608
1,3-difluoro-2-isothiocyanato-5-[2-(4-propoxyphenyl)ethynyl]benzene (PubChem CID 101359608) has the molecular formula C18H13F2NOS and a molecular weight of 329.37 g/mol. Its IUPAC name is 1,3-difluoro-2-isothiocyanato-5-[2-(4-propoxyphenyl)ethynyl]benzene.
| Compound Name | 1,3-difluoro-2-isothiocyanato-5-[2-(4-propoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 101359608 |
| Molecular Formula | C18H13F2NOS |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1,3-difluoro-2-isothiocyanato-5-[2-(4-propoxyphenyl)ethynyl]benzene |
| SMILES | CCCOc1ccc(C#Cc2cc(F)c(N=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C18H13F2NOS/c1-2-9-22-15-7-5-13(6-8-15)3-4-14-10-16(19)18(21-12-23)17(20)11-14/h5-8,10-11H,2,9H2,1H3 |
| InChIKey | RBIDHMDBGDXVRX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|