C16H12F3NO — CID 23190806
2,3,6-trifluoro-5-[2-(4-propoxyphenyl)ethynyl]pyridine (PubChem CID 23190806) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 2,3,6-trifluoro-5-[2-(4-propoxyphenyl)ethynyl]pyridine.
| Compound Name | 2,3,6-trifluoro-5-[2-(4-propoxyphenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 23190806 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2,3,6-trifluoro-5-[2-(4-propoxyphenyl)ethynyl]pyridine |
| SMILES | CCCOc1ccc(C#Cc2cc(F)c(F)nc2F)cc1 |
| InChI | InChI=1S/C16H12F3NO/c1-2-9-21-13-7-4-11(5-8-13)3-6-12-10-14(17)16(19)20-15(12)18/h4-5,7-8,10H,2,9H2,1H3 |
| InChIKey | RXLROGSZLLOBOT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|