C21H17F2NO — CID 102499066
3,4-difluoro-1-[4-[2-(4-propoxyphenyl)ethynyl]phenyl]pyrrole (PubChem CID 102499066) has the molecular formula C21H17F2NO and a molecular weight of 337.37 g/mol. Its IUPAC name is 3,4-difluoro-1-[4-[2-(4-propoxyphenyl)ethynyl]phenyl]pyrrole.
| Compound Name | 3,4-difluoro-1-[4-[2-(4-propoxyphenyl)ethynyl]phenyl]pyrrole |
|---|---|
| PubChem CID | 102499066 |
| Molecular Formula | C21H17F2NO |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3,4-difluoro-1-[4-[2-(4-propoxyphenyl)ethynyl]phenyl]pyrrole |
| SMILES | CCCOc1ccc(C#Cc2ccc(-n3cc(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C21H17F2NO/c1-2-13-25-19-11-7-17(8-12-19)4-3-16-5-9-18(10-6-16)24-14-20(22)21(23)15-24/h5-12,14-15H,2,13H2,1H3 |
| InChIKey | GZHACTIXQILNRL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|