C20H17F2NO — CID 23190649
2,3-difluoro-5-[4-(4-propoxyphenyl)phenyl]pyridine (PubChem CID 23190649) has the molecular formula C20H17F2NO and a molecular weight of 325.36 g/mol. Its IUPAC name is 2,3-difluoro-5-[4-(4-propoxyphenyl)phenyl]pyridine.
| Compound Name | 2,3-difluoro-5-[4-(4-propoxyphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 23190649 |
| Molecular Formula | C20H17F2NO |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2,3-difluoro-5-[4-(4-propoxyphenyl)phenyl]pyridine |
| SMILES | CCCOc1ccc(-c2ccc(-c3cnc(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C20H17F2NO/c1-2-11-24-18-9-7-15(8-10-18)14-3-5-16(6-4-14)17-12-19(21)20(22)23-13-17/h3-10,12-13H,2,11H2,1H3 |
| InChIKey | LYPXMBRQAFIERV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|