C14H13F2NO — CID 19765788
2,6-difluoro-3-(4-propoxyphenyl)pyridine (PubChem CID 19765788) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 2,6-difluoro-3-(4-propoxyphenyl)pyridine.
| Compound Name | 2,6-difluoro-3-(4-propoxyphenyl)pyridine |
|---|---|
| PubChem CID | 19765788 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2,6-difluoro-3-(4-propoxyphenyl)pyridine |
| SMILES | CCCOc1ccc(-c2ccc(F)nc2F)cc1 |
| InChI | InChI=1S/C14H13F2NO/c1-2-9-18-11-5-3-10(4-6-11)12-7-8-13(15)17-14(12)16/h3-8H,2,9H2,1H3 |
| InChIKey | NFZAAOAWKXMWLS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|