C20H17F3O2 — CID 90128789
1,2,8-trifluoro-3-methoxy-7-(4-propoxyphenyl)naphthalene (PubChem CID 90128789) has the molecular formula C20H17F3O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1,2,8-trifluoro-3-methoxy-7-(4-propoxyphenyl)naphthalene.
| Compound Name | 1,2,8-trifluoro-3-methoxy-7-(4-propoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 90128789 |
| Molecular Formula | C20H17F3O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1,2,8-trifluoro-3-methoxy-7-(4-propoxyphenyl)naphthalene |
| SMILES | CCCOc1ccc(-c2ccc3cc(OC)c(F)c(F)c3c2F)cc1 |
| InChI | InChI=1S/C20H17F3O2/c1-3-10-25-14-7-4-12(5-8-14)15-9-6-13-11-16(24-2)19(22)20(23)17(13)18(15)21/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | HWEOFMYTLBAOOX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |