C28H16F4 — CID 139850630
6-[2-(4-ethylphenyl)ethynyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]naphthalene (PubChem CID 139850630) has the molecular formula C28H16F4 and a molecular weight of 428.43 g/mol. Its IUPAC name is 6-[2-(4-ethylphenyl)ethynyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]naphthalene.
| Compound Name | 6-[2-(4-ethylphenyl)ethynyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850630 |
| Molecular Formula | C28H16F4 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 6-[2-(4-ethylphenyl)ethynyl]-1-fluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]naphthalene |
| SMILES | CCc1ccc(C#Cc2ccc3c(F)c(C#Cc4cc(F)c(F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H16F4/c1-2-18-3-5-19(6-4-18)7-8-20-10-14-24-23(15-20)13-12-22(27(24)31)11-9-21-16-25(29)28(32)26(30)17-21/h3-6,10,12-17H,2H2,1H3 |
| InChIKey | PQTPIMYUGDVSDA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|