C21H12F3N — CID 139851320
4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2,6-difluorobenzonitrile (PubChem CID 139851320) has the molecular formula C21H12F3N and a molecular weight of 335.33 g/mol. Its IUPAC name is 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139851320 |
| Molecular Formula | C21H12F3N |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2,6-difluorobenzonitrile |
| SMILES | CCc1ccc2c(F)c(C#Cc3cc(F)c(C#N)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C21H12F3N/c1-2-13-4-8-17-16(9-13)7-6-15(21(17)24)5-3-14-10-19(22)18(12-25)20(23)11-14/h4,6-11H,2H2,1H3 |
| InChIKey | GGXXWIAVYRTWHN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|