C33H34F3N — CID 139851407
2,6-difluoro-4-[2-[1-fluoro-6-[2-(4-hexylcyclohexyl)ethyl]naphthalen-2-yl]ethynyl]benzonitrile (PubChem CID 139851407) has the molecular formula C33H34F3N and a molecular weight of 501.64 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[1-fluoro-6-[2-(4-hexylcyclohexyl)ethyl]naphthalen-2-yl]ethynyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(4-hexylcyclohexyl)ethyl]naphthalen-2-yl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 139851407 |
| Molecular Formula | C33H34F3N |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(4-hexylcyclohexyl)ethyl]naphthalen-2-yl]ethynyl]benzonitrile |
| SMILES | CCCCCCC1CCC(CCc2ccc3c(F)c(C#Cc4cc(F)c(C#N)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C33H34F3N/c1-2-3-4-5-6-23-7-9-24(10-8-23)11-12-25-14-18-29-28(19-25)17-16-27(33(29)36)15-13-26-20-31(34)30(22-37)32(35)21-26/h14,16-21,23-24H,2-12H2,1H3 |
| InChIKey | JVGOJCHCIVHGPO-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|