C26H22F3N — CID 139850994
2,6-difluoro-4-[2-(1-fluoro-6-heptylnaphthalen-2-yl)ethynyl]benzonitrile (PubChem CID 139850994) has the molecular formula C26H22F3N and a molecular weight of 405.46 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-(1-fluoro-6-heptylnaphthalen-2-yl)ethynyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-(1-fluoro-6-heptylnaphthalen-2-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 139850994 |
| Molecular Formula | C26H22F3N |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2,6-difluoro-4-[2-(1-fluoro-6-heptylnaphthalen-2-yl)ethynyl]benzonitrile |
| SMILES | CCCCCCCc1ccc2c(F)c(C#Cc3cc(F)c(C#N)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C26H22F3N/c1-2-3-4-5-6-7-18-9-13-22-21(14-18)12-11-20(26(22)29)10-8-19-15-24(27)23(17-30)25(28)16-19/h9,11-16H,2-7H2,1H3 |
| InChIKey | FCYSANFPRUPUTN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|