C34H30F6 — CID 139851602
2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoro-6-[2-(4-heptylphenyl)ethyl]naphthalene (PubChem CID 139851602) has the molecular formula C34H30F6 and a molecular weight of 552.60 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoro-6-[2-(4-heptylphenyl)ethyl]naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoro-6-[2-(4-heptylphenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 139851602 |
| Molecular Formula | C34H30F6 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-1-fluoro-6-[2-(4-heptylphenyl)ethyl]naphthalene |
| SMILES | CCCCCCCc1ccc(CCc2ccc3c(F)c(C#Cc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C34H30F6/c1-2-3-4-5-6-7-23-8-10-24(11-9-23)12-13-25-15-19-29-28(20-25)18-17-27(33(29)37)16-14-26-21-30(35)32(31(36)22-26)34(38,39)40/h8-11,15,17-22H,2-7,12-13H2,1H3 |
| InChIKey | ZUMYDTKBKIIQHY-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|