C21H13F2N — CID 139851411
4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2-fluorobenzonitrile (PubChem CID 139851411) has the molecular formula C21H13F2N and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 139851411 |
| Molecular Formula | C21H13F2N |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[2-(6-ethyl-1-fluoronaphthalen-2-yl)ethynyl]-2-fluorobenzonitrile |
| SMILES | CCc1ccc2c(F)c(C#Cc3ccc(C#N)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C21H13F2N/c1-2-14-5-10-19-17(11-14)9-8-16(21(19)23)6-3-15-4-7-18(13-24)20(22)12-15/h4-5,7-12H,2H2,1H3 |
| InChIKey | CNPHNERWZAHGPU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|