C26H31FO2 — CID 158807191
4-[2-(4-ethylphenyl)ethynyl]-2-fluoro-1-(4-propylcyclohexyl)oxybenzene;formaldehyde (PubChem CID 158807191) has the molecular formula C26H31FO2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethynyl]-2-fluoro-1-(4-propylcyclohexyl)oxybenzene;formaldehyde.
| Compound Name | 4-[2-(4-ethylphenyl)ethynyl]-2-fluoro-1-(4-propylcyclohexyl)oxybenzene;formaldehyde |
|---|---|
| PubChem CID | 158807191 |
| Molecular Formula | C26H31FO2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethynyl]-2-fluoro-1-(4-propylcyclohexyl)oxybenzene;formaldehyde |
| SMILES | C=O.CCCC1CCC(Oc2ccc(C#Cc3ccc(CC)cc3)cc2F)CC1 |
| InChI | InChI=1S/C25H29FO.CH2O/c1-3-5-20-12-15-23(16-13-20)27-25-17-14-22(18-24(25)26)11-10-21-8-6-19(4-2)7-9-21;1-2/h6-9,14,17-18,20,23H,3-5,12-13,15-16H2,1-2H3;1H2 |
| InChIKey | IUFKLDAFQNWUIE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|