C16H9F2NS2 — CID 178054336
2-cyclopropyl-5-[2-(2,5-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene (PubChem CID 178054336) has the molecular formula C16H9F2NS2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-cyclopropyl-5-[2-(2,5-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene.
| Compound Name | 2-cyclopropyl-5-[2-(2,5-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
|---|---|
| PubChem CID | 178054336 |
| Molecular Formula | C16H9F2NS2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-cyclopropyl-5-[2-(2,5-difluoro-4-isothiocyanatophenyl)ethynyl]thiophene |
| SMILES | Fc1cc(N=C=S)c(F)cc1C#Cc1ccc(C2CC2)s1 |
| InChI | InChI=1S/C16H9F2NS2/c17-13-8-15(19-9-20)14(18)7-11(13)3-4-12-5-6-16(21-12)10-1-2-10/h5-8,10H,1-2H2 |
| InChIKey | RCFVJFLCLKHAPJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|