C24H15F2NS2 — CID 178054376
2-cyclopent-3-en-1-yl-5-[2-[2,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]ethynyl]thiophene (PubChem CID 178054376) has the molecular formula C24H15F2NS2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-cyclopent-3-en-1-yl-5-[2-[2,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]ethynyl]thiophene.
| Compound Name | 2-cyclopent-3-en-1-yl-5-[2-[2,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]ethynyl]thiophene |
|---|---|
| PubChem CID | 178054376 |
| Molecular Formula | C24H15F2NS2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-cyclopent-3-en-1-yl-5-[2-[2,5-difluoro-4-(4-isothiocyanatophenyl)phenyl]ethynyl]thiophene |
| SMILES | Fc1cc(-c2ccc(N=C=S)cc2)c(F)cc1C#Cc1ccc(C2CC=CC2)s1 |
| InChI | InChI=1S/C24H15F2NS2/c25-22-14-21(16-5-8-19(9-6-16)27-15-28)23(26)13-18(22)7-10-20-11-12-24(29-20)17-3-1-2-4-17/h1-2,5-6,8-9,11-14,17H,3-4H2 |
| InChIKey | PPQCVNBAKNJLDS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|