C15H18F2OS2 — CID 134451308
3,4-difluoro-2-(5-hexylthiophen-2-yl)-5-methoxythiophene (PubChem CID 134451308) has the molecular formula C15H18F2OS2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3,4-difluoro-2-(5-hexylthiophen-2-yl)-5-methoxythiophene.
| Compound Name | 3,4-difluoro-2-(5-hexylthiophen-2-yl)-5-methoxythiophene |
|---|---|
| PubChem CID | 134451308 |
| Molecular Formula | C15H18F2OS2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3,4-difluoro-2-(5-hexylthiophen-2-yl)-5-methoxythiophene |
| SMILES | CCCCCCc1ccc(-c2sc(OC)c(F)c2F)s1 |
| InChI | InChI=1S/C15H18F2OS2/c1-3-4-5-6-7-10-8-9-11(19-10)14-12(16)13(17)15(18-2)20-14/h8-9H,3-7H2,1-2H3 |
| InChIKey | PUMNREIDVRFGEB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|