C22H41NS — CID 139385862
5-hexyl-2-[(6S,7S)-7-methyldodecan-6-yl]-1,3-thiazole (PubChem CID 139385862) has the molecular formula C22H41NS and a molecular weight of 351.64 g/mol. Its IUPAC name is 5-hexyl-2-[(6S,7S)-7-methyldodecan-6-yl]-1,3-thiazole.
| Compound Name | 5-hexyl-2-[(6S,7S)-7-methyldodecan-6-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 139385862 |
| Molecular Formula | C22H41NS |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | 5-hexyl-2-[(6S,7S)-7-methyldodecan-6-yl]-1,3-thiazole |
| SMILES | CCCCCCc1cnc([C@@H](CCCCC)[C@@H](C)CCCCC)s1 |
| InChI | InChI=1S/C22H41NS/c1-5-8-11-14-16-20-18-23-22(24-20)21(17-13-10-7-3)19(4)15-12-9-6-2/h18-19,21H,5-17H2,1-4H3/t19-,21-/m0/s1 |
| InChIKey | ZLVDFORRCHGTQJ-FPOVZHCZSA-N |
| XLogP | 8.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|