C10H16N2O5S2 — CID 118622139
ethyl 5-(4-methylsulfonyloxybutyl)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 118622139) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 5-(4-methylsulfonyloxybutyl)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-(4-methylsulfonyloxybutyl)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 118622139 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl 5-(4-methylsulfonyloxybutyl)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(CCCCOS(C)(=O)=O)s1 |
| InChI | InChI=1S/C10H16N2O5S2/c1-3-16-10(13)9-12-11-8(18-9)6-4-5-7-17-19(2,14)15/h3-7H2,1-2H3 |
| InChIKey | MVXUBWKZSREEPT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|