C7H8N2O3S — CID 22123179
5-(4-oxobutyl)-1,3,4-thiadiazole-2-carboxylic acid (PubChem CID 22123179) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 5-(4-oxobutyl)-1,3,4-thiadiazole-2-carboxylic acid.
| Compound Name | 5-(4-oxobutyl)-1,3,4-thiadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 22123179 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 5-(4-oxobutyl)-1,3,4-thiadiazole-2-carboxylic acid |
| SMILES | O=CCCCc1nnc(C(=O)O)s1 |
| InChI | InChI=1S/C7H8N2O3S/c10-4-2-1-3-5-8-9-6(13-5)7(11)12/h4H,1-3H2,(H,11,12) |
| InChIKey | OHIDEAYVTKMCSK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|