About lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid
lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid (PubChem CID 175461334) has the molecular formula C4H5LiN2O2S
and a molecular weight of 152.10 g/mol. Its IUPAC name is lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid |
| PubChem CID | 175461334 |
| Molecular Formula | C4H5LiN2O2S |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid |
| SMILES | Cc1nnc(C(=O)O)s1.[H-].[Li+] |
| InChI | InChI=1S/C4H4N2O2S.Li.H/c1-2-5-6-3(9-2)4(7)8;;/h1H3,(H,7,8);;/q;+1;-1 |
| InChIKey | VUQUCEKUTSJWLN-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid?
The IUPAC name of lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid (CID 175461334) is lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid.
What is the SMILES notation for lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid?
The canonical SMILES for lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid is Cc1nnc(C(=O)O)s1.[H-].[Li+].
What is the InChIKey of lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid?
The InChIKey is VUQUCEKUTSJWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S.Li.H/c1-2-5-6-3(9-2)4(7)8;;/h1H3,(H,7,8);;/q;+1;-1.
What are the key properties of lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid?
lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid has a molecular weight of 152.10 g/mol, XLogP of -2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;5-methyl-1,3,4-thiadiazole-2-carboxylic acid is sourced from PubChem (CID 175461334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).