C4H6N4OS — CID 130690461
5-methyl-1,3,4-thiadiazole-2-carbohydrazide (PubChem CID 130690461) has the molecular formula C4H6N4OS and a molecular weight of 158.19 g/mol. Its IUPAC name is 5-methyl-1,3,4-thiadiazole-2-carbohydrazide.
| Compound Name | 5-methyl-1,3,4-thiadiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 130690461 |
| Molecular Formula | C4H6N4OS |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 5-methyl-1,3,4-thiadiazole-2-carbohydrazide |
| SMILES | Cc1nnc(C(=O)NN)s1 |
| InChI | InChI=1S/C4H6N4OS/c1-2-7-8-4(10-2)3(9)6-5/h5H2,1H3,(H,6,9) |
| InChIKey | RSTDPTAGAHSZJV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|