About trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate
trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126499) has the molecular formula C5H3F3N2O2S
and a molecular weight of 212.15 g/mol. Its IUPAC name is trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate.
Analyze trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The IUPAC name of trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate (CID 59126499) is trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate.
What is the SMILES notation for trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The canonical SMILES for trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate is Cc1nnc(C(=O)OC(F)(F)F)s1.
What is the InChIKey of trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The InChIKey is RDYFMEZJAUZLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2O2S/c1-2-9-10-3(13-2)4(11)12-5(6,7)8/h1H3.
What are the key properties of trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate has a molecular weight of 212.15 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate is sourced from PubChem (CID 59126499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).