C6H8N2O2S — CID 130639064
(5-methyl-1,3,4-thiadiazol-2-yl)methyl acetate (PubChem CID 130639064) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is (5-methyl-1,3,4-thiadiazol-2-yl)methyl acetate.
| Compound Name | (5-methyl-1,3,4-thiadiazol-2-yl)methyl acetate |
|---|---|
| PubChem CID | 130639064 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (5-methyl-1,3,4-thiadiazol-2-yl)methyl acetate |
| SMILES | CC(=O)OCc1nnc(C)s1 |
| InChI | InChI=1S/C6H8N2O2S/c1-4-7-8-6(11-4)3-10-5(2)9/h3H2,1-2H3 |
| InChIKey | XMCUNILXQHQMRY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |