C6H10N2OS — CID 65208576
1-(5-methyl-1,3,4-thiadiazol-2-yl)propan-2-ol (PubChem CID 65208576) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-thiadiazol-2-yl)propan-2-ol.
| Compound Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 65208576 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)propan-2-ol |
| SMILES | Cc1nnc(CC(C)O)s1 |
| InChI | InChI=1S/C6H10N2OS/c1-4(9)3-6-8-7-5(2)10-6/h4,9H,3H2,1-2H3 |
| InChIKey | NERPIGDWMXXHLH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |