C6H9ClN2S — CID 65208736
2-(2-chloropropyl)-5-methyl-1,3,4-thiadiazole (PubChem CID 65208736) has the molecular formula C6H9ClN2S and a molecular weight of 176.67 g/mol. Its IUPAC name is 2-(2-chloropropyl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(2-chloropropyl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 65208736 |
| Molecular Formula | C6H9ClN2S |
| Molecular Weight | 176.67 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-(2-chloropropyl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(CC(C)Cl)s1 |
| InChI | InChI=1S/C6H9ClN2S/c1-4(7)3-6-9-8-5(2)10-6/h4H,3H2,1-2H3 |
| InChIKey | VJIQDWWRAPVGPK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|