C8H13BrN2S — CID 164654249
2-(3-bromo-2-methylbutyl)-5-methyl-1,3,4-thiadiazole (PubChem CID 164654249) has the molecular formula C8H13BrN2S and a molecular weight of 249.18 g/mol. Its IUPAC name is 2-(3-bromo-2-methylbutyl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(3-bromo-2-methylbutyl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 164654249 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(3-bromo-2-methylbutyl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(CC(C)C(C)Br)s1 |
| InChI | InChI=1S/C8H13BrN2S/c1-5(6(2)9)4-8-11-10-7(3)12-8/h5-6H,4H2,1-3H3 |
| InChIKey | GGRZIXYGLUKPGI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|