About 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one
3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one (PubChem CID 65208677) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one.
Analyze 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one?
The IUPAC name of 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one (CID 65208677) is 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one.
What is the SMILES notation for 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one?
The canonical SMILES for 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one is Cc1nnc(CC(=O)C(C)C)s1.
What is the InChIKey of 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one?
The InChIKey is ZWVBUMSUJPJXFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-5(2)7(11)4-8-10-9-6(3)12-8/h5H,4H2,1-3H3.
What are the key properties of 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one?
3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one has a molecular weight of 184.26 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)butan-2-one is sourced from PubChem (CID 65208677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).