C8H13N3OS — CID 110870149
N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]butanamide (PubChem CID 110870149) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]butanamide.
| Compound Name | N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110870149 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]butanamide |
| SMILES | CCCC(=O)NCc1nnc(C)s1 |
| InChI | InChI=1S/C8H13N3OS/c1-3-4-7(12)9-5-8-11-10-6(2)13-8/h3-5H2,1-2H3,(H,9,12) |
| InChIKey | IXEUFQUAWJPJET-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |