About methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate
methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate (PubChem CID 110870268) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate.
Analyze methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate?
The IUPAC name of methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate (CID 110870268) is methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate is COC(=O)NCCc1nnc(C)s1.
What is the InChIKey of methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate?
The InChIKey is JKMLFLMJABTZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-5-9-10-6(13-5)3-4-8-7(11)12-2/h3-4H2,1-2H3,(H,8,11).
What are the key properties of methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate?
methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate has a molecular weight of 201.25 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]carbamate is sourced from PubChem (CID 110870268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).