C11H10N2OS2 — CID 121223002
O-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl] benzenecarbothioate (PubChem CID 121223002) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is O-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl] benzenecarbothioate.
| Compound Name | O-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl] benzenecarbothioate |
|---|---|
| PubChem CID | 121223002 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | O-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl] benzenecarbothioate |
| SMILES | Cc1nnc(COC(=S)c2ccccc2)s1 |
| InChI | InChI=1S/C11H10N2OS2/c1-8-12-13-10(16-8)7-14-11(15)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | VLCDZKIFIOAGEY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|