C10H9IN2OS — CID 164653697
2-[(3-iodophenoxy)methyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 164653697) has the molecular formula C10H9IN2OS and a molecular weight of 332.17 g/mol. Its IUPAC name is 2-[(3-iodophenoxy)methyl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[(3-iodophenoxy)methyl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 164653697 |
| Molecular Formula | C10H9IN2OS |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-[(3-iodophenoxy)methyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(COc2cccc(I)c2)s1 |
| InChI | InChI=1S/C10H9IN2OS/c1-7-12-13-10(15-7)6-14-9-4-2-3-8(11)5-9/h2-5H,6H2,1H3 |
| InChIKey | HSXUWZMKPCFOOP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|