C11H10N4OS2 — CID 693358
N-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide (PubChem CID 693358) has the molecular formula C11H10N4OS2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 693358 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | N-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1nnc(NC(=S)NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C11H10N4OS2/c1-7-14-15-11(18-7)13-10(17)12-9(16)8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,13,15,16,17) |
| InChIKey | DPRGMRDPRUDAHR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|