C18H14FN3OS2 — CID 164687705
4-fluoro-N-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamothioyl]benzamide (PubChem CID 164687705) has the molecular formula C18H14FN3OS2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 4-fluoro-N-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 164687705 |
| Molecular Formula | C18H14FN3OS2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-fluoro-N-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2ccc(F)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14FN3OS2/c1-11-15(12-5-3-2-4-6-12)20-18(25-11)22-17(24)21-16(23)13-7-9-14(19)10-8-13/h2-10H,1H3,(H2,20,21,22,23,24) |
| InChIKey | BVDOJIVOESPANS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|