C12H12N2OS2 — CID 82422746
2-[(2-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide (PubChem CID 82422746) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-[(2-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-[(2-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82422746 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[(2-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1ccccc1OCc1ncc(C(N)=S)s1 |
| InChI | InChI=1S/C12H12N2OS2/c1-8-4-2-3-5-9(8)15-7-11-14-6-10(17-11)12(13)16/h2-6H,7H2,1H3,(H2,13,16) |
| InChIKey | HUSYEKUDEGWFCP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|